CAS 2768207-01-6 is the registry number for 3,3,4,5,5-Pentamethylmorpholine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3,4,5,5-pentamethylmorpholine-2,6-dione (CAS 2768207-01-6) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 3,3,4,5,5-pentamethylmorpholine-2,6-dione. InChIKey: DEOSHWYUGSZGHS-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 3,3,4,5,5-pentamethylmorpholine-2,6-dione |
| InChIKey | DEOSHWYUGSZGHS-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)OC(=O)C(N1C)(C)C)C |
Computed by PubChem (NCBI)