Products 2768265-58-1
CAS 2768265-58-1 is the registry number for Aha1/Hsp90-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[4-methoxy-3-(3-methoxyphenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]tetrazole (CAS 2768265-58-1) is a chemical compound with the molecular formula C22H17F3N4O2 and a molecular weight of 426.4 g/mol. IUPAC name: 5-[4-methoxy-3-(3-methoxyphenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]tetrazole. InChIKey: DFAYTMMBPZGUIS-UHFFFAOYSA-N.
| Molecular formula | C22H17F3N4O2 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | 5-[4-methoxy-3-(3-methoxyphenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]tetrazole |
| InChIKey | DFAYTMMBPZGUIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN=NN2C3=CC=C(C=C3)C(F)(F)F)C4=CC(=CC=C4)OC |
Computed by PubChem (NCBI)
Synonyms:
Aha1/Hsp90-IN-1, orb1687735