CAS 2768322-91-2 is the registry number for 5-Bromo-3-methyl-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-1,2,4-triazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane (CAS 2768322-91-2) is a chemical compound with the molecular formula C9H18BrN3OSi and a molecular weight of 292.25 g/mol. IUPAC name: 2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: RCLXUCDRVJTBQW-UHFFFAOYSA-N.
| Molecular formula | C9H18BrN3OSi |
|---|---|
| Molecular weight | 292.25 g/mol |
| IUPAC name | 2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | RCLXUCDRVJTBQW-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)Br)COCC[Si](C)(C)C |
Computed by PubChem (NCBI)