Products 2768326-58-3
CAS 2768326-58-3 appears in our catalog under these names: 5-Bromo-6-fluoroisoindoline (hydrochloride), 98%, 5-Bromo-6-fluoroisoindoline hydrochloride, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride (CAS 2768326-58-3) is a chemical compound with the molecular formula C8H8BrClFN and a molecular weight of 252.51 g/mol. IUPAC name: 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: ACOGAZHNBUMGGS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClFN |
|---|---|
| Molecular weight | 252.51 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | ACOGAZHNBUMGGS-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2CN1)Br)F.Cl |
Computed by PubChem (NCBI)