Products 2768474-47-9
CAS 2768474-47-9 is the registry number for Haspin-IN-2. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
2-methoxy-10-nitropyrido[3,4-g]quinazoline (CAS 2768474-47-9) is a chemical compound with the molecular formula C12H8N4O3 and a molecular weight of 256.22 g/mol. IUPAC name: 2-methoxy-10-nitropyrido[3,4-g]quinazoline. InChIKey: WPPGBVWZGMDXKF-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O3 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | 2-methoxy-10-nitropyrido[3,4-g]quinazoline |
| InChIKey | WPPGBVWZGMDXKF-UHFFFAOYSA-N |
| SMILES | COC1=NC=C2C=C3C=NC=CC3=C(C2=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Haspin-IN-2, orb1689626