CAS 276860-60-7 is the registry number for 2-((2S,6R)-2,6-Dimethylmorpholino)ethanol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanol (CAS 276860-60-7) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanol. InChIKey: VAFPVCCEXLHAGE-OCAPTIKFSA-N.
| Molecular formula | C8H17NO2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanol |
| InChIKey | VAFPVCCEXLHAGE-OCAPTIKFSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CCO |
Computed by PubChem (NCBI)