Products 2768663-15-4
CAS 2768663-15-4 appears in our catalog under these names: (2S,4S)-4-(([1,1'-Biphenyl]-4-ylmethyl)amino)pyrrolidine-2-carboxylic acid hydrochloride, 98%, SN40 hydrochloride, SN40 (hydrochloride), 98.00%, SN40 HCl, 98%. Offered by: BLDpharm, GLPBio, MedChemExpress, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 1mg, 5mg, 5 mg.
(2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 2768663-15-4) is a chemical compound with the molecular formula C18H21ClN2O2 and a molecular weight of 332.8 g/mol. IUPAC name: (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: SCVJDDMQQPCHCV-QJHJCNPRSA-N.
| Molecular formula | C18H21ClN2O2 |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | SCVJDDMQQPCHCV-QJHJCNPRSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)NCC2=CC=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)
Synonyms:
orb2283480