Products 276872-81-2

CAS 276872-81-2 is the registry number for 4-[(4-Fluorophenyl)methyl]-1-piperidinecarboxylic acid 1,1-dimethylethyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[(4-fluorophenyl)methyl]piperidine-1-carboxylate (CAS 276872-81-2) is a chemical compound with the molecular formula C17H24FNO2 and a molecular weight of 293.4 g/mol. IUPAC name: tert-butyl 4-[(4-fluorophenyl)methyl]piperidine-1-carboxylate. InChIKey: GHMYVSNELKFYHM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24FNO2
Molecular weight293.4 g/mol
IUPAC nametert-butyl 4-[(4-fluorophenyl)methyl]piperidine-1-carboxylate
InChIKeyGHMYVSNELKFYHM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)CC2=CC=C(C=C2)F

Computed by PubChem (NCBI)