CAS 2768870-88-6 is the registry number for 6-Bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile (CAS 2768870-88-6) is a chemical compound with the molecular formula C8H3BrIN3 and a molecular weight of 347.94 g/mol. IUPAC name: 6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile. InChIKey: TZKDHJFAADKRJT-UHFFFAOYSA-N.
| Molecular formula | C8H3BrIN3 |
|---|---|
| Molecular weight | 347.94 g/mol |
| IUPAC name | 6-bromo-8-iodoimidazo[1,2-a]pyridine-7-carbonitrile |
| InChIKey | TZKDHJFAADKRJT-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C(=C(C2=N1)I)C#N)Br |
Computed by PubChem (NCBI)