CAS 2768871-67-4 is the registry number for 1-(Difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2768871-67-4) is a chemical compound with the molecular formula C10H15BF2N2O2 and a molecular weight of 244.05 g/mol. IUPAC name: 1-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: VXMPJUCJXAAPFU-UHFFFAOYSA-N.
| Molecular formula | C10H15BF2N2O2 |
|---|---|
| Molecular weight | 244.05 g/mol |
| IUPAC name | 1-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | VXMPJUCJXAAPFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C(F)F |
Computed by PubChem (NCBI)