Products 2768872-53-1
CAS 2768872-53-1 is the registry number for tert-Butyl (5-bromo-4-cyano-3-iodopyridin-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(5-bromo-4-cyano-3-iodo-2-pyridinyl)carbamate (CAS 2768872-53-1) is a chemical compound with the molecular formula C11H11BrIN3O2 and a molecular weight of 424.03 g/mol. IUPAC name: tert-butyl N-(5-bromo-4-cyano-3-iodo-2-pyridinyl)carbamate. InChIKey: LUTMBRBLXIHUJD-UHFFFAOYSA-N.
| Molecular formula | C11H11BrIN3O2 |
|---|---|
| Molecular weight | 424.03 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-4-cyano-3-iodo-2-pyridinyl)carbamate |
| InChIKey | LUTMBRBLXIHUJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C(=C1I)C#N)Br |
Computed by PubChem (NCBI)