Products 2768874-42-4
CAS 2768874-42-4 is the registry number for (5-Amino-6-cyanopyridin-3-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-amino-6-cyano-3-pyridinyl)boronic acid (CAS 2768874-42-4) is a chemical compound with the molecular formula C6H6BN3O2 and a molecular weight of 162.94 g/mol. IUPAC name: (5-amino-6-cyano-3-pyridinyl)boronic acid. InChIKey: LRRHEXUECUZZJE-UHFFFAOYSA-N.
| Molecular formula | C6H6BN3O2 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | (5-amino-6-cyano-3-pyridinyl)boronic acid |
| InChIKey | LRRHEXUECUZZJE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C#N)N)(O)O |
Computed by PubChem (NCBI)