CAS 2769040-08-4 is the registry number for NLRP3-IN-31. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyridazin-4-amine (CAS 2769040-08-4) is a chemical compound with the molecular formula C18H17ClN4O and a molecular weight of 340.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyridazin-4-amine. InChIKey: CWKRBIAXTXXNBA-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN4O |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)pyrido[3,4-d]pyridazin-4-amine |
| InChIKey | CWKRBIAXTXXNBA-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNC2=NN=C(C3=C2C=NC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)