CAS 2769775-04-2 is the registry number for 4,4,5,5-Tetramethyl-2-(3-phenyldibenzo[b,d]furan-1-yl)-1,3,2-dioxaborolane, 99.5%, 99.5%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.
4,4,5,5-tetramethyl-2-(3-phenyldibenzofuran-1-yl)-1,3,2-dioxaborolane (CAS 2769775-04-2) is a chemical compound with the molecular formula C24H23BO3 and a molecular weight of 370.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-phenyldibenzofuran-1-yl)-1,3,2-dioxaborolane. InChIKey: UPYXCRFNROOTTR-UHFFFAOYSA-N.
| Molecular formula | C24H23BO3 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-phenyldibenzofuran-1-yl)-1,3,2-dioxaborolane |
| InChIKey | UPYXCRFNROOTTR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C4=CC=CC=C4O3)C5=CC=CC=C5 |
Computed by PubChem (NCBI)