CAS 1616120-14-9 is the registry number for 2-(3-(Dibenzo[b,d]furan-1-yl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-(3-dibenzofuran-1-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1616120-14-9) is a chemical compound with the molecular formula C24H23BO3 and a molecular weight of 370.2 g/mol. IUPAC name: 2-(3-dibenzofuran-1-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OTSLXOCVFAFXAC-UHFFFAOYSA-N.
| Molecular formula | C24H23BO3 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 2-(3-dibenzofuran-1-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OTSLXOCVFAFXAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=C4C5=CC=CC=C5OC4=CC=C3 |
Computed by PubChem (NCBI)