CAS 2769817-70-9 is the registry number for 1,3-Dimethyl-5-(methylsulfonyl)-1H-pyrazolo[4,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-5-methylsulfonylpyrazolo[4,3-d]pyrimidine (CAS 2769817-70-9) is a chemical compound with the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. IUPAC name: 1,3-dimethyl-5-methylsulfonylpyrazolo[4,3-d]pyrimidine. InChIKey: BTGWLUHMOCCEPJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2S |
|---|---|
| Molecular weight | 226.26 g/mol |
| IUPAC name | 1,3-dimethyl-5-methylsulfonylpyrazolo[4,3-d]pyrimidine |
| InChIKey | BTGWLUHMOCCEPJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=CN=C(N=C12)S(=O)(=O)C)C |
Computed by PubChem (NCBI)