CAS 2769863-44-5 is the registry number for Calcium (D,L)-Pantoate (Calcium (RS)-2,4-Dihydroxy-3,3-dimethylbutyrate). Offered by: Mikromol. Available pack sizes: 50mg.
Calcium bis(2,4-dihydroxy-3,3-dimethylbutanoate) (CAS 2769863-44-5) is a chemical compound with the molecular formula C12H22CaO8 and a molecular weight of 334.38 g/mol. IUPAC name: calcium bis(2,4-dihydroxy-3,3-dimethylbutanoate). InChIKey: NLYWNOMRYSPWQC-UHFFFAOYSA-L.
| Molecular formula | C12H22CaO8 |
|---|---|
| Molecular weight | 334.38 g/mol |
| IUPAC name | calcium bis(2,4-dihydroxy-3,3-dimethylbutanoate) |
| InChIKey | NLYWNOMRYSPWQC-UHFFFAOYSA-L |
| SMILES | CC(C)(CO)C(C(=O)[O-])O.CC(C)(CO)C(C(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)