CAS 2770009-06-6 appears in our catalog under these names: EGFR mutant–IN–2, EGFR mutant-IN-2 98%, EGFR mutant-IN-2, 97.0%. Offered by: GLPBio, Ambeed, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 100 mg, 25 mg.
1-[2-(dimethylamino)ethyl]-N-[4-(1-ethylsulfonylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]indol-5-amine (CAS 2770009-06-6) is a chemical compound with the molecular formula C27H27F3N6O2S and a molecular weight of 556.6 g/mol. IUPAC name: 1-[2-(dimethylamino)ethyl]-N-[4-(1-ethylsulfonylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]indol-5-amine. InChIKey: YETCUDGHQDLIRZ-UHFFFAOYSA-N.
| Molecular formula | C27H27F3N6O2S |
|---|---|
| Molecular weight | 556.6 g/mol |
| IUPAC name | 1-[2-(dimethylamino)ethyl]-N-[4-(1-ethylsulfonylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]indol-5-amine |
| InChIKey | YETCUDGHQDLIRZ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1C=C(C2=CC=CC=C21)C3=NC(=NC=C3C(F)(F)F)NC4=CC5=C(C=C4)N(C=C5)CCN(C)C |
Computed by PubChem (NCBI)