Products 2770091-44-4
CAS 2770091-44-4 is the registry number for WNTinib, 99.95%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 5 mg, 10mM/1mL, 100 mg, 25 mg.
4-[3-fluoro-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide (CAS 2770091-44-4) is a chemical compound with the molecular formula C22H16F6N4O3 and a molecular weight of 498.4 g/mol. IUPAC name: 4-[3-fluoro-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide. InChIKey: URCPDENSDRVZDE-UHFFFAOYSA-N.
| Molecular formula | C22H16F6N4O3 |
|---|---|
| Molecular weight | 498.4 g/mol |
| IUPAC name | 4-[3-fluoro-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| InChIKey | URCPDENSDRVZDE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC=C(C=C3)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)
Synonyms:
WNTinib, orb2565055