CAS 2770246-11-0 appears in our catalog under these names: HSD17B13–IN–43, HSD17B13-IN-43, 99.68%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100 mg, 5 mg, 10 mg, 50 mg, 25 mg.
3,5-dichloro-4-hydroxy-N-[4-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-5-yl]benzamide (CAS 2770246-11-0) is a chemical compound with the molecular formula C23H14Cl2F3N3O3 and a molecular weight of 508.3 g/mol. IUPAC name: 3,5-dichloro-4-hydroxy-N-[4-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-5-yl]benzamide. InChIKey: AZLYYNIXTDGFFV-UHFFFAOYSA-N.
| Molecular formula | C23H14Cl2F3N3O3 |
|---|---|
| Molecular weight | 508.3 g/mol |
| IUPAC name | 3,5-dichloro-4-hydroxy-N-[4-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-5-yl]benzamide |
| InChIKey | AZLYYNIXTDGFFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CN2C=NC3=C(C2=O)C(=CC=C3)NC(=O)C4=CC(=C(C(=C4)Cl)O)Cl |
Computed by PubChem (NCBI)