CAS 2770246-48-3 is the registry number for HSD17B13-IN-29. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dichloro-N-[3-[(2-cyanophenyl)methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide (CAS 2770246-48-3) is a chemical compound with the molecular formula C23H14Cl2N4O3 and a molecular weight of 465.3 g/mol. IUPAC name: 3,5-dichloro-N-[3-[(2-cyanophenyl)methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide. InChIKey: CEDWRVDOKSMNOJ-UHFFFAOYSA-N.
| Molecular formula | C23H14Cl2N4O3 |
|---|---|
| Molecular weight | 465.3 g/mol |
| IUPAC name | 3,5-dichloro-N-[3-[(2-cyanophenyl)methyl]-4-oxoquinazolin-5-yl]-4-hydroxybenzamide |
| InChIKey | CEDWRVDOKSMNOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=NC3=C(C2=O)C(=CC=C3)NC(=O)C4=CC(=C(C(=C4)Cl)O)Cl)C#N |
Computed by PubChem (NCBI)