Products 2770280-70-9
CAS 2770280-70-9 is the registry number for Myosin-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[[(1S)-1-(2-fluoro-5-methylphenyl)ethyl]amino]-3-(oxan-4-yl)-1H-1,3,5-triazine-2,4-dione (CAS 2770280-70-9) is a chemical compound with the molecular formula C17H21FN4O3 and a molecular weight of 348.4 g/mol. IUPAC name: 6-[[(1S)-1-(2-fluoro-5-methylphenyl)ethyl]amino]-3-(oxan-4-yl)-1H-1,3,5-triazine-2,4-dione. InChIKey: PDWCGWLAOPQSPH-NSHDSACASA-N.
| Molecular formula | C17H21FN4O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 6-[[(1S)-1-(2-fluoro-5-methylphenyl)ethyl]amino]-3-(oxan-4-yl)-1H-1,3,5-triazine-2,4-dione |
| InChIKey | PDWCGWLAOPQSPH-NSHDSACASA-N |
| SMILES | CC1=CC(=C(C=C1)F)[C@H](C)NC2=NC(=O)N(C(=O)N2)C3CCOCC3 |
Computed by PubChem (NCBI)
Synonyms:
Myosin-IN-2, orb3173332