Products 2770347-99-2
CAS 2770347-99-2 is the registry number for (1-(Trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-yl]methyl 4-methylbenzenesulfonate (CAS 2770347-99-2) is a chemical compound with the molecular formula C14H15F3O4S and a molecular weight of 336.33 g/mol. IUPAC name: [1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-yl]methyl 4-methylbenzenesulfonate. InChIKey: IJKYHWQSXLKWOK-UHFFFAOYSA-N.
| Molecular formula | C14H15F3O4S |
|---|---|
| Molecular weight | 336.33 g/mol |
| IUPAC name | [1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | IJKYHWQSXLKWOK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC23CC(C2)(OC3)C(F)(F)F |
Computed by PubChem (NCBI)