Products 2197056-70-3
CAS 2197056-70-3 appears in our catalog under these names: 1,1-Dioxo-4-([4-(trifluoromethyl)phenyl]methyl)-1lambda(6)-thiane-4-carboxylic acid, 95%, 4-(4-(Trifluoromethyl)benzyl)tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1,1-dioxo-4-[[4-(trifluoromethyl)phenyl]methyl]thiane-4-carboxylic acid (CAS 2197056-70-3) is a chemical compound with the molecular formula C14H15F3O4S and a molecular weight of 336.33 g/mol. IUPAC name: 1,1-dioxo-4-[[4-(trifluoromethyl)phenyl]methyl]thiane-4-carboxylic acid. InChIKey: TVUXGAURHSIBPH-UHFFFAOYSA-N.
| Molecular formula | C14H15F3O4S |
|---|---|
| Molecular weight | 336.33 g/mol |
| IUPAC name | 1,1-dioxo-4-[[4-(trifluoromethyl)phenyl]methyl]thiane-4-carboxylic acid |
| InChIKey | TVUXGAURHSIBPH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC2=CC=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)