CAS 2770403-97-7 is the registry number for 3-(1,1-Difluoro-2,2-dimethylpropyl)isoxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-5-amine (CAS 2770403-97-7) is a chemical compound with the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. IUPAC name: 3-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-5-amine. InChIKey: WTHVXVQXOGFYLB-UHFFFAOYSA-N.
| Molecular formula | C8H12F2N2O |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-5-amine |
| InChIKey | WTHVXVQXOGFYLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=NOC(=C1)N)(F)F |
Computed by PubChem (NCBI)