Products 27705-05-1

CAS 27705-05-1 is the registry number for 4-Chloro-3-cyclohexene-1-carboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 500mg, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-chlorocyclohex-3-ene-1-carboxylate (CAS 27705-05-1) is a chemical compound with the molecular formula C8H11ClO2 and a molecular weight of 174.62 g/mol. IUPAC name: methyl 4-chlorocyclohex-3-ene-1-carboxylate. InChIKey: AXGMDZQLJZXOJK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClO2
Molecular weight174.62 g/mol
IUPAC namemethyl 4-chlorocyclohex-3-ene-1-carboxylate
InChIKeyAXGMDZQLJZXOJK-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(=CC1)Cl

Computed by PubChem (NCBI)