Products 2770585-67-4

CAS 2770585-67-4 is the registry number for T638, 98.61%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 10mM/1mL, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-(2-amino-4-anilinophenyl)-2-sulfanylidene-1H-pyridine-3-carboxamide (CAS 2770585-67-4) is a chemical compound with the molecular formula C18H16N4OS and a molecular weight of 336.4 g/mol. IUPAC name: N-(2-amino-4-anilinophenyl)-2-sulfanylidene-1H-pyridine-3-carboxamide. InChIKey: IIUONQJTTGSQCA-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16N4OS
Molecular weight336.4 g/mol
IUPAC nameN-(2-amino-4-anilinophenyl)-2-sulfanylidene-1H-pyridine-3-carboxamide
InChIKeyIIUONQJTTGSQCA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC2=CC(=C(C=C2)NC(=O)C3=CC=CNC3=S)N

Computed by PubChem (NCBI)

Synonyms: orb2646396