CAS 2770896-14-3 is the registry number for tert-Butyl (2S,4R)-4-cyano-2-methylpyrrolidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
Tert-butyl (2S,4R)-4-cyano-2-methylpyrrolidine-1-carboxylate (CAS 2770896-14-3) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl (2S,4R)-4-cyano-2-methylpyrrolidine-1-carboxylate. InChIKey: PVSSRFOUDVSLLJ-IUCAKERBSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-cyano-2-methylpyrrolidine-1-carboxylate |
| InChIKey | PVSSRFOUDVSLLJ-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)