CAS 1245908-97-7 is the registry number for (S)-2-Isocyanomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (2S)-2-(isocyanomethyl)pyrrolidine-1-carboxylate (CAS 1245908-97-7) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl (2S)-2-(isocyanomethyl)pyrrolidine-1-carboxylate. InChIKey: RHJWPRSOYYDGJX-VIFPVBQESA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl (2S)-2-(isocyanomethyl)pyrrolidine-1-carboxylate |
| InChIKey | RHJWPRSOYYDGJX-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C[N+]#[C-] |
Computed by PubChem (NCBI)