Products 1245908-97-7

CAS 1245908-97-7 is the registry number for (S)-2-Isocyanomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl (2S)-2-(isocyanomethyl)pyrrolidine-1-carboxylate (CAS 1245908-97-7) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl (2S)-2-(isocyanomethyl)pyrrolidine-1-carboxylate. InChIKey: RHJWPRSOYYDGJX-VIFPVBQESA-N.

Identity
Molecular formulaC11H18N2O2
Molecular weight210.27 g/mol
IUPAC nametert-butyl (2S)-2-(isocyanomethyl)pyrrolidine-1-carboxylate
InChIKeyRHJWPRSOYYDGJX-VIFPVBQESA-N
SMILESCC(C)(C)OC(=O)N1CCC[C@H]1C[N+]#[C-]

Computed by PubChem (NCBI)