Products 2771-53-1

CAS 2771-53-1 is the registry number for Ethyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 5g.

Structural formula: {0} (CAS {1})

[(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl] acetate (CAS 2771-53-1) is a chemical compound with the molecular formula C13H20O7S and a molecular weight of 320.36 g/mol. IUPAC name: [(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl] acetate. InChIKey: OTSSLPCTZZILDD-XQHKEYJVSA-N.

Identity
Molecular formulaC13H20O7S
Molecular weight320.36 g/mol
IUPAC name[(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl] acetate
InChIKeyOTSSLPCTZZILDD-XQHKEYJVSA-N
SMILESCCS[C@H]1[C@@H]([C@H]([C@@H](CO1)OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)