CAS 2771010-43-4 is the registry number for (S)-1-(6-Bromopyridin-3-yl)-2,2,2-trifluoro-N-methylethan-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(6-bromo-3-pyridinyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride (CAS 2771010-43-4) is a chemical compound with the molecular formula C8H9BrClF3N2 and a molecular weight of 305.52 g/mol. IUPAC name: (1S)-1-(6-bromo-3-pyridinyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride. InChIKey: NFPUXPWOYOYZHP-FJXQXJEOSA-N.
| Molecular formula | C8H9BrClF3N2 |
|---|---|
| Molecular weight | 305.52 g/mol |
| IUPAC name | (1S)-1-(6-bromo-3-pyridinyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride |
| InChIKey | NFPUXPWOYOYZHP-FJXQXJEOSA-N |
| SMILES | CN[C@@H](C1=CN=C(C=C1)Br)C(F)(F)F.Cl |
Computed by PubChem (NCBI)