CAS 2771023-14-2 is the registry number for 6'-Bromo-5'-fluoro-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinolin]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5-fluorospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CAS 2771023-14-2) is a chemical compound with the molecular formula C11H9BrFNO and a molecular weight of 270.10 g/mol. IUPAC name: 6-bromo-5-fluorospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one. InChIKey: URCQRIFIRJPFEJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO |
|---|---|
| Molecular weight | 270.10 g/mol |
| IUPAC name | 6-bromo-5-fluorospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| InChIKey | URCQRIFIRJPFEJ-UHFFFAOYSA-N |
| SMILES | C1CC12CNC(=O)C3=C2C(=C(C=C3)Br)F |
Computed by PubChem (NCBI)