CAS 2771023-28-8 is the registry number for rel-Methyl 4-bromo-2-((1R,2S)-1-cyano-2-fluorocyclopropyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-2-[(1R,2S)-1-cyano-2-fluorocyclopropyl]benzoate (CAS 2771023-28-8) is a chemical compound with the molecular formula C12H9BrFNO2 and a molecular weight of 298.11 g/mol. IUPAC name: methyl 4-bromo-2-[(1R,2S)-1-cyano-2-fluorocyclopropyl]benzoate. InChIKey: AZQINCAINICIOC-JQWIXIFHSA-N.
| Molecular formula | C12H9BrFNO2 |
|---|---|
| Molecular weight | 298.11 g/mol |
| IUPAC name | methyl 4-bromo-2-[(1R,2S)-1-cyano-2-fluorocyclopropyl]benzoate |
| InChIKey | AZQINCAINICIOC-JQWIXIFHSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)[C@]2(C[C@@H]2F)C#N |
Computed by PubChem (NCBI)