CAS 2771081-10-6 is the registry number for 3,5-Dibromo-4-methyl-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,5-dibromo-4-methylpyrazol-1-yl)methoxy]ethyl-trimethylsilane (CAS 2771081-10-6) is a chemical compound with the molecular formula C10H18Br2N2OSi and a molecular weight of 370.16 g/mol. IUPAC name: 2-[(3,5-dibromo-4-methylpyrazol-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: QBHSEYYGCVPZKO-UHFFFAOYSA-N.
| Molecular formula | C10H18Br2N2OSi |
|---|---|
| Molecular weight | 370.16 g/mol |
| IUPAC name | 2-[(3,5-dibromo-4-methylpyrazol-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | QBHSEYYGCVPZKO-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1Br)COCC[Si](C)(C)C)Br |
Computed by PubChem (NCBI)