CAS 2771132-14-8 appears in our catalog under these names: 8-Bromo-2,3-dihydro-5H-benzo(e)(1,4)oxathiepine 1,1-dioxide, 97%, 8-Bromo-2,3-dihydro-5H-benzo[e][1,4]oxathiepine 1,1-dioxide, 97%, 97%, 8-bromo-3,5-dihydro-2H-4,1benzoxathiepine 1,1-dioxide, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g.
8-bromo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine 1,1-dioxide (CAS 2771132-14-8) is a chemical compound with the molecular formula C9H9BrO3S and a molecular weight of 277.14 g/mol. IUPAC name: 8-bromo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine 1,1-dioxide. InChIKey: OSKMUIRCPOUZLP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3S |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | 8-bromo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine 1,1-dioxide |
| InChIKey | OSKMUIRCPOUZLP-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(CO1)C=CC(=C2)Br |
Computed by PubChem (NCBI)