CAS 2771352-36-2 is the registry number for tert-butyl 4-[(5-bromo-2-chloro-4-pyridyl)methyl]-4-hydroxy-piperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 4-[(5-bromo-2-chloro-4-pyridinyl)methyl]-4-hydroxypiperidine-1-carboxylate (CAS 2771352-36-2) is a chemical compound with the molecular formula C16H22BrClN2O3 and a molecular weight of 405.7 g/mol. IUPAC name: tert-butyl 4-[(5-bromo-2-chloro-4-pyridinyl)methyl]-4-hydroxypiperidine-1-carboxylate. InChIKey: NBBPXOCMWVIJFI-UHFFFAOYSA-N.
| Molecular formula | C16H22BrClN2O3 |
|---|---|
| Molecular weight | 405.7 g/mol |
| IUPAC name | tert-butyl 4-[(5-bromo-2-chloro-4-pyridinyl)methyl]-4-hydroxypiperidine-1-carboxylate |
| InChIKey | NBBPXOCMWVIJFI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CC2=CC(=NC=C2Br)Cl)O |
Computed by PubChem (NCBI)