Products 2771352-91-9
CAS 2771352-91-9 is the registry number for tert-Butyl 6'-fluoro-3'H-spiro[azetidine-3,2'-furo[2,3-b]pyridine]-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-fluorospiro[3H-furo[2,3-b]pyridine-2,3'-azetidine]-1'-carboxylate (CAS 2771352-91-9) is a chemical compound with the molecular formula C14H17FN2O3 and a molecular weight of 280.29 g/mol. IUPAC name: tert-butyl 6-fluorospiro[3H-furo[2,3-b]pyridine-2,3'-azetidine]-1'-carboxylate. InChIKey: JLAKBLGORYPIAE-UHFFFAOYSA-N.
| Molecular formula | C14H17FN2O3 |
|---|---|
| Molecular weight | 280.29 g/mol |
| IUPAC name | tert-butyl 6-fluorospiro[3H-furo[2,3-b]pyridine-2,3'-azetidine]-1'-carboxylate |
| InChIKey | JLAKBLGORYPIAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC3=C(O2)N=C(C=C3)F |
Computed by PubChem (NCBI)