Products 2772-37-4
CAS 2772-37-4 is the registry number for 4-{2-(1-(4-Bromophenyl)ethylidene)hydrazin-1-yl}benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]benzoic acid (CAS 2772-37-4) is a chemical compound with the molecular formula C15H13BrN2O2 and a molecular weight of 333.18 g/mol. IUPAC name: 4-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]benzoic acid. InChIKey: KIDMHWNTSMNJAV-LICLKQGHSA-N.
| Molecular formula | C15H13BrN2O2 |
|---|---|
| Molecular weight | 333.18 g/mol |
| IUPAC name | 4-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]benzoic acid |
| InChIKey | KIDMHWNTSMNJAV-LICLKQGHSA-N |
| SMILES | C/C(=N\NC1=CC=C(C=C1)C(=O)O)/C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)