CAS 2772702-10-8 appears in our catalog under these names: Peldesine dihydrochloride, Peldesine dihydrochloride, Peldesine (dihydrochloride), 99%, 99%, Peldesine (dihydrochloride), 99.28%, Peldesine (dihydrochloride) (Standard). Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 5mg, 25mg, 50mg, 100mg, 1mg, 5 mg.
2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one;dihydrochloride (CAS 2772702-10-8) is a chemical compound with the molecular formula C12H13Cl2N5O and a molecular weight of 314.17 g/mol. IUPAC name: 2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one;dihydrochloride. InChIKey: HQJPQOLISXXDRJ-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2N5O |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | 2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one;dihydrochloride |
| InChIKey | HQJPQOLISXXDRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC2=CNC3=C2N=C(NC3=O)N.Cl.Cl |
Computed by PubChem (NCBI)