CAS 277295-50-8 is the registry number for 3-(N,N-Dimethylsulfamoylamino)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-(dimethylsulfamoylamino)phenyl]boronic acid (CAS 277295-50-8) is a chemical compound with the molecular formula C8H13BN2O4S and a molecular weight of 244.08 g/mol. IUPAC name: [3-(dimethylsulfamoylamino)phenyl]boronic acid. InChIKey: UHPQMFBFPJCLDX-UHFFFAOYSA-N.
| Molecular formula | C8H13BN2O4S |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | [3-(dimethylsulfamoylamino)phenyl]boronic acid |
| InChIKey | UHPQMFBFPJCLDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NS(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)