CAS 277309-46-3 is the registry number for 2-{6-((benzyloxy)methoxy)-3-oxo-3H-xanthen-9-yl}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[3-oxo-6-(phenylmethoxymethoxy)xanthen-9-yl]benzoic acid (CAS 277309-46-3) is a chemical compound with the molecular formula C28H20O6 and a molecular weight of 452.5 g/mol. IUPAC name: 2-[3-oxo-6-(phenylmethoxymethoxy)xanthen-9-yl]benzoic acid. InChIKey: SLGGBXGUZVBTAO-UHFFFAOYSA-N.
| Molecular formula | C28H20O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 2-[3-oxo-6-(phenylmethoxymethoxy)xanthen-9-yl]benzoic acid |
| InChIKey | SLGGBXGUZVBTAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCOC2=CC3=C(C=C2)C(=C4C=CC(=O)C=C4O3)C5=CC=CC=C5C(=O)O |
Computed by PubChem (NCBI)