CAS 277316-57-1 appears in our catalog under these names: Boc-L-cysteic Acid, Boc-L-cysteic acid 98%, L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-3-sulfo-, 97%, 97%, Boc-L-Cysteic acid, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100g, 100mg, 250mg, 1g, 5g, 10g, 25g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfopropanoic acid (CAS 277316-57-1) is a chemical compound with the molecular formula C8H15NO7S and a molecular weight of 269.27 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfopropanoic acid. InChIKey: OBDTYOCDTWYTGV-YFKPBYRVSA-N.
| Molecular formula | C8H15NO7S |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfopropanoic acid |
| InChIKey | OBDTYOCDTWYTGV-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)