CAS 277331-50-7 is the registry number for 3-(3-Bromo-phenyl)-propionic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Tert-butyl 3-(3-bromophenyl)propanoate (CAS 277331-50-7) is a chemical compound with the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. IUPAC name: tert-butyl 3-(3-bromophenyl)propanoate. InChIKey: OZTQLFWKFCKBDX-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO2 |
|---|---|
| Molecular weight | 285.18 g/mol |
| IUPAC name | tert-butyl 3-(3-bromophenyl)propanoate |
| InChIKey | OZTQLFWKFCKBDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)