Products 2773475-11-7

CAS 2773475-11-7 is the registry number for ETI60. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 5 mg, 50 mg, 25 mg.

Structural formula: {0} (CAS {1})

6-[3-(dimethylamino)propyl]-8-methoxy-1,2,3,4-tetrahydroindolo[2,3-b]quinolin-11-amine (CAS 2773475-11-7) is a chemical compound with the molecular formula C21H28N4O and a molecular weight of 352.5 g/mol. IUPAC name: 6-[3-(dimethylamino)propyl]-8-methoxy-1,2,3,4-tetrahydroindolo[2,3-b]quinolin-11-amine. InChIKey: KMJZZIXZIRUHOF-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28N4O
Molecular weight352.5 g/mol
IUPAC name6-[3-(dimethylamino)propyl]-8-methoxy-1,2,3,4-tetrahydroindolo[2,3-b]quinolin-11-amine
InChIKeyKMJZZIXZIRUHOF-UHFFFAOYSA-N
SMILESCN(C)CCCN1C2=C(C=CC(=C2)OC)C3=C(C4=C(CCCC4)N=C31)N

Computed by PubChem (NCBI)

Synonyms: orb3173699