CAS 2773477-72-6 is the registry number for Lithium 3-(1-(methylsulfonyl)cyclopropyl)-1,2,4-thiadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 3-(1-methylsulfonylcyclopropyl)-1,2,4-thiadiazole-5-carboxylate (CAS 2773477-72-6) is a chemical compound with the molecular formula C7H7LiN2O4S2 and a molecular weight of 254.2 g/mol. IUPAC name: lithium 3-(1-methylsulfonylcyclopropyl)-1,2,4-thiadiazole-5-carboxylate. InChIKey: XEZYWZHLVLMDEZ-UHFFFAOYSA-M.
| Molecular formula | C7H7LiN2O4S2 |
|---|---|
| Molecular weight | 254.2 g/mol |
| IUPAC name | lithium 3-(1-methylsulfonylcyclopropyl)-1,2,4-thiadiazole-5-carboxylate |
| InChIKey | XEZYWZHLVLMDEZ-UHFFFAOYSA-M |
| SMILES | [Li+].CS(=O)(=O)C1(CC1)C2=NSC(=N2)C(=O)[O-] |
Computed by PubChem (NCBI)