CAS 2773477-78-2 is the registry number for Lithium 5-(1-(methylsulfonyl)cyclopropyl)-1,3,4-oxadiazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylate (CAS 2773477-78-2) is a chemical compound with the molecular formula C7H7LiN2O5S and a molecular weight of 238.2 g/mol. IUPAC name: lithium 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: RYJDTJIZJODKST-UHFFFAOYSA-M.
| Molecular formula | C7H7LiN2O5S |
|---|---|
| Molecular weight | 238.2 g/mol |
| IUPAC name | lithium 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | RYJDTJIZJODKST-UHFFFAOYSA-M |
| SMILES | [Li+].CS(=O)(=O)C1(CC1)C2=NN=C(O2)C(=O)[O-] |
Computed by PubChem (NCBI)