CAS 2773477-86-2 is the registry number for tert-Butyl (3-(4-bromothiazol-2-yl)bicyclo[1.1.1]pentan-1-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-(4-bromo-1,3-thiazol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate (CAS 2773477-86-2) is a chemical compound with the molecular formula C13H17BrN2O2S and a molecular weight of 345.26 g/mol. IUPAC name: tert-butyl N-[3-(4-bromo-1,3-thiazol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate. InChIKey: LJESSHPUXGDPHE-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2S |
|---|---|
| Molecular weight | 345.26 g/mol |
| IUPAC name | tert-butyl N-[3-(4-bromo-1,3-thiazol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| InChIKey | LJESSHPUXGDPHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C3=NC(=CS3)Br |
Computed by PubChem (NCBI)