Products 2773478-08-1
CAS 2773478-08-1 is the registry number for Ethyl 3-(1-(methylsulfonyl)cyclopropyl)-1,2,4-thiadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(1-methylsulfonylcyclopropyl)-1,2,4-thiadiazole-5-carboxylate (CAS 2773478-08-1) is a chemical compound with the molecular formula C9H12N2O4S2 and a molecular weight of 276.3 g/mol. IUPAC name: ethyl 3-(1-methylsulfonylcyclopropyl)-1,2,4-thiadiazole-5-carboxylate. InChIKey: CRXOWJBAFDVDRL-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S2 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | ethyl 3-(1-methylsulfonylcyclopropyl)-1,2,4-thiadiazole-5-carboxylate |
| InChIKey | CRXOWJBAFDVDRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NS1)C2(CC2)S(=O)(=O)C |
Computed by PubChem (NCBI)