CAS 2773489-99-7 is the registry number for 5-Bromo-6-iodo-7-isopropyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 2773489-99-7) is a chemical compound with the molecular formula C9H10BrIN4 and a molecular weight of 381.01 g/mol. IUPAC name: 5-bromo-6-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: RATMDBGFRIDDQK-UHFFFAOYSA-N.
| Molecular formula | C9H10BrIN4 |
|---|---|
| Molecular weight | 381.01 g/mol |
| IUPAC name | 5-bromo-6-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | RATMDBGFRIDDQK-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=C(C2=C(N=CN=C21)N)Br)I |
Computed by PubChem (NCBI)