Products 2773490-24-5
CAS 2773490-24-5 is the registry number for 5-Bromo-4-chloro-6-iodopyrrolo[2,1-f][1,2,4]triazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-chloro-6-iodopyrrolo[2,1-f][1,2,4]triazine (CAS 2773490-24-5) is a chemical compound with the molecular formula C6H2BrClIN3 and a molecular weight of 358.36 g/mol. IUPAC name: 5-bromo-4-chloro-6-iodopyrrolo[2,1-f][1,2,4]triazine. InChIKey: QAWMVAXUWPIUBO-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClIN3 |
|---|---|
| Molecular weight | 358.36 g/mol |
| IUPAC name | 5-bromo-4-chloro-6-iodopyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | QAWMVAXUWPIUBO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2N1N=CN=C2Cl)Br)I |
Computed by PubChem (NCBI)